ambidentate ligand. 양쪽 자리성 리간드

ambidentate ligand. 양쪽 자리성 리간드

 

---------------------------------------------------

▶ 참고: 몇 가지 일반적인 리간드

[ https://ywpop.tistory.com/4811 ]

---------------------------------------------------

 

▶ Ambidentate ligands are “monodentate ligands”

that have can bind in two possible places.

 

▶ 전자쌍을 제공할 수 있는 원자가 2개이지만, 한자리 리간드.

 

▶ 배위 결합 가능한 원자가 2개이지만,

2개 원자가 동시에 결합하지는 않는다.

 

▶ ambidentate ligand를 포함하는 (대부분의) 착물은

2개의 결합 이성질체 (linkage isomers) 를 갖는다.

( 참고 https://ywpop.tistory.com/10881 )

 

 

 

 

▶ nitrite ion, NO2^-

> NO2^- can bond either through the nitrogen atom or the oxygen atom, but not at the same time.

 

M ← NO2 ... 질소로 배위, nitro isomer

M ← ONO ... 산소로 배위, nitrito isomer

 

 

 

 

▶ thiocyanate ion, SCN^-

> SCN^- can bond either through the sulphur atom or the nitrogen atom, but not at the same time.

 

M ← SCN ... 황으로 배위, thiocyanato isomer

M ← NCS ... 질소로 배위, isothiocyanato isomer

 

 

 

[그림] Structure of Pd(Me2N(CH2)3PPh2)(SCN)(NCS).

 

 

 

 

▶ cyanide, CN^-

> CN^- can bond either through the carbon atom or the nitrogen atom, but not at the same time.

 

M ← CN

M ← NC

( 참고 https://www.chem.purdue.edu/gchelp/cchem/linki.html )

 

 

 

 

▶ DMSO

> DMSO can bond either through the sulphur atom or the oxygen atom, but not at the same time.

 

M ← OS(CH3)2

M ← SO(CH3)2

 

 

 

[ 그림 출처 commons.wikimedia.org ]

 

 

 

 

[키워드] 양쪽 자리성 리간드 기준문서, 여러 자리성 리간드 기준문서, 결합 이성질체 기준문서